3-phenyl-1-[5-(phenylthiocarbamoylamino)pentyl]thiourea structure
|
Common Name | 3-phenyl-1-[5-(phenylthiocarbamoylamino)pentyl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 52420-80-1 | Molecular Weight | 372.55100 | |
| Density | 1.244g/cm3 | Boiling Point | 517.2ºC at 760 mmHg | |
| Molecular Formula | C19H24N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | 1-phenyl-3-[5-(phenylcarbamothioylamino)pentyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 517.2ºC at 760 mmHg |
| Molecular Formula | C19H24N4S2 |
| Molecular Weight | 372.55100 |
| Flash Point | 266.6ºC |
| Exact Mass | 372.14400 |
| PSA | 112.30000 |
| LogP | 5.05770 |
| Index of Refraction | 1.691 |
| InChIKey | NWDCVSVUPSSRAM-UHFFFAOYSA-N |
| SMILES | S=C(NCCCCCNC(=S)Nc1ccccc1)Nc1ccccc1 |
|
~%
3-phenyl-1-[5-(... CAS#:52420-80-1 |
| Literature: Cutter; Taras Industrial and Engineering Chemistry, Analytical Edition, 1941 , vol. 13, p. 830 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N',N'''-pentane-1,5-diylbis[1-phenyl(thiourea)] |