N-[4-(benzhydrylsulfamoyl)phenyl]acetamide
Modify Date: 2025-09-09 11:19:59
![N-[4-(benzhydrylsulfamoyl)phenyl]acetamide Structure](https://image.chemsrc.com/caspic/273/5243-41-4.png)
N-[4-(benzhydrylsulfamoyl)phenyl]acetamide structure
|
Common Name | N-[4-(benzhydrylsulfamoyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5243-41-4 | Molecular Weight | 222.23700 | |
| Density | 1.243g/cm3 | Boiling Point | 380.2ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2-(2-phenylpropan-2-yl)malonic acid |
|---|
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 197.9ºC |
| Exact Mass | 222.08900 |
| PSA | 74.60000 |
| LogP | 1.74960 |
| Index of Refraction | 1.55 |
| InChIKey | JUWWNFJHVAYDKK-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)C(C(=O)O)C(=O)O |
| HS Code | 2917399090 |
|---|
|
~83%
N-[4-(benzhydry... CAS#:5243-41-4 |
| Literature: Holmberg, Carl Liebigs Annalen der Chemie, 1981 , # 4 p. 748 - 760 |
|
~%
N-[4-(benzhydry... CAS#:5243-41-4 |
| Literature: Holmberg, Carl Liebigs Annalen der Chemie, 1981 , # 4 p. 748 - 760 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:3910-35-8| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |