3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-thiazolidin-4-one
3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-thiazolidin-4-one structure
|
Common Name | 3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 5243-65-2 | Molecular Weight | 250.34000 | |
| Density | 1.39g/cm3 | Boiling Point | 387.3ºC at 760 mmHg | |
| Molecular Formula | C11H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 387.3ºC at 760 mmHg |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.34000 |
| Flash Point | 188ºC |
| Exact Mass | 250.02300 |
| PSA | 90.59000 |
| LogP | 2.24060 |
| Index of Refraction | 1.699 |
| InChIKey | MNWKVEIZMVREIO-CLFYSBASSA-N |
| SMILES | CCN1C(=O)C(=Cc2ccccn2)SC1=S |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-ethyl-5-(pyri... CAS#:5243-65-2 |
| Literature: Allan,F.J. et al. Recueil des Travaux Chimiques des Pays-Bas, 1961 , vol. 80, p. 403 - 408 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: Related upstream materials(CAS) of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one: 1121-60-4;7648-01-3. |
| Q: What is the SMILES notation of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: SMILES notation of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is CCN1C(=O)C(=Cc2ccccn2)SC1=S. |
| Q: What is the Chinese name of 5243-65-2? |
| A: Chinese name of 5243-65-2 is 5243-65-2. |
| Q: What is the InChIKey of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: InChIKey of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is MNWKVEIZMVREIO-CLFYSBASSA-N. |
| Q: What is the boiling point of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: Boiling point of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is 387.3ºC at 760 mmHg. |
| Q: What is the CAS number of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: CAS number of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is 5243-65-2. |
| Q: What is the molecular formula of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: Molecular formula of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is C11H10N2OS2. |
| Q: What is the LogP of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: LogP of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is 2.24060. |
| Q: What is the molecular weight of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: Molecular weight of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is 250.34000. |
| Q: What is the polar surface area (PSA) of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one? |
| A: Polar surface area (PSA) of (5Z)-3-ethyl-5-(pyridin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one is 90.59000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |