7-nitro-5-phenyl-1-prop-2-ynyl-3H-1,4-benzodiazepin-2-one structure
|
Common Name | 7-nitro-5-phenyl-1-prop-2-ynyl-3H-1,4-benzodiazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 52465-42-6 | Molecular Weight | 319.31400 | |
| Density | 1.25g/cm3 | Boiling Point | 564.4ºC at 760 mmHg | |
| Molecular Formula | C18H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-nitro-5-phenyl-1-prop-2-ynyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 564.4ºC at 760 mmHg |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.31400 |
| Exact Mass | 319.09600 |
| PSA | 78.49000 |
| LogP | 2.43580 |
| Index of Refraction | 1.636 |
| InChIKey | CPRXMYGXMWGHJX-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-1,4-Benzodiazepin-2-one,1,3-dihydro-7-nitro-5-phenyl-1-(2-propynyl) |
| 7-Nitro-2,3-dihydro-5-phenyl-1-propargyl-1H-1,4-benzodiazepin-2-one |
| 1,3-Dihydro-7-nitro-5-phenyl-1-(2-propynyl)-2H-1,4-benzodiazepin-2-one |