2-AMINO-1-(2-NITRO-PHENYL)-ETHANONE structure
|
Common Name | 2-AMINO-1-(2-NITRO-PHENYL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 524698-41-7 | Molecular Weight | 180.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-1-(2-nitrophenyl)ethanone |
|---|
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16100 |
| Exact Mass | 180.05300 |
| PSA | 88.91000 |
| LogP | 1.95970 |
| InChIKey | XRXIPRFKMDVCMB-UHFFFAOYSA-N |
| SMILES | NCC(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2922399090 |
|---|
|
~%
2-AMINO-1-(2-NI... CAS#:524698-41-7 |
| Literature: Umio,S. et al. Chemical and Pharmaceutical Bulletin, 1969 , vol. 17, p. 596 - 604 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |