butyl 5-oxocyclopent-1-ene-1-heptanoate structure
|
Common Name | butyl 5-oxocyclopent-1-ene-1-heptanoate | ||
|---|---|---|---|---|
| CAS Number | 52477-97-1 | Molecular Weight | 266.37600 | |
| Density | 1g/cm3 | Boiling Point | 372.6ºC at 760mmHg | |
| Molecular Formula | C16H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | butyl 7-(5-oxocyclopenten-1-yl)heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760mmHg |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.37600 |
| Flash Point | 160.9ºC |
| Exact Mass | 266.18800 |
| PSA | 43.37000 |
| LogP | 3.95960 |
| Index of Refraction | 1.479 |
| InChIKey | IQOYCLGKUZQIQH-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCCCCCC1=CCCC1=O |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| butyl 7-(5-oxocyclopent-1-en-1-yl)heptanoate |
| Butyl 5-oxocyclopent-1-ene-1-heptanoate |
| EINECS 257-944-3 |