2-methoxy-4-methyl-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine
Modify Date: 2025-09-09 08:17:40
2-methoxy-4-methyl-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine structure
|
Common Name | 2-methoxy-4-methyl-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 5248-44-2 | Molecular Weight | 285.34400 | |
| Density | 1.204g/cm3 | Boiling Point | 490.9ºC at 760 mmHg | |
| Molecular Formula | C15H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.7ºC | |
| Name | 2-methoxy-4-methyl-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine |
|---|
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 490.9ºC at 760 mmHg |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.34400 |
| Flash Point | 250.7ºC |
| Exact Mass | 285.15900 |
| PSA | 54.38000 |
| LogP | 1.64520 |
| Index of Refraction | 1.592 |
| InChIKey | YNUZDFQZJAQZCV-UHFFFAOYSA-N |
| SMILES | COc1nc(C)nc(N2CCN(c3ccccc3)CC2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |