6-(3,5-dimethoxyphenyl)-6-oxohexanoic acid
Modify Date: 2024-02-03 20:51:52
6-(3,5-dimethoxyphenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(3,5-dimethoxyphenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 52483-37-1 | Molecular Weight | 266.29000 | |
| Density | 1.159g/cm3 | Boiling Point | 449.4ºC at 760 mmHg | |
| Molecular Formula | C14H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 6-(3,5-dimethoxyphenyl)-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 449.4ºC at 760 mmHg |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29000 |
| Flash Point | 167.4ºC |
| Exact Mass | 266.11500 |
| PSA | 72.83000 |
| LogP | 2.53150 |
| Index of Refraction | 1.519 |
| InChIKey | YBPCENYTKUORGX-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(=O)CCCCC(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(3',5'-Dimethoxybenzoyl)pentansaeure |