5-m-tolylamino-[1,3,4]thiadiazole-2-thiol structure
|
Common Name | 5-m-tolylamino-[1,3,4]thiadiazole-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 52494-32-3 | Molecular Weight | 223.31800 | |
| Density | 1.42g/cm3 | Boiling Point | 331ºC at 760mmHg | |
| Molecular Formula | C9H9N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-methylanilino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 331ºC at 760mmHg |
| Molecular Formula | C9H9N3S2 |
| Molecular Weight | 223.31800 |
| Exact Mass | 223.02400 |
| PSA | 101.04000 |
| LogP | 3.32570 |
| Index of Refraction | 1.736 |
| InChIKey | DRCBGFQZMQJJJL-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Nc2n[nH]c(=S)s2)c1 |
| HS Code | 2934999090 |
|---|
|
~84%
5-m-tolylamino-... CAS#:52494-32-3 |
| Literature: Chu, Chang-Hu; Hui, Xin-Ping; Xu, Peng-Fei; Zhang, Zi-Yi; Li, Zhi-Chun; Liao, Ren-An Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 11 p. 2436 - 2438 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(3-toluidino)-1,3,4-thiadiazole-2-thiol |
| 5-m-Tolylamino-[1,3,4]thiadiazole-2-thiol |