1-(4-Chlorophenyl)-3-(3-methyl-2-pyridinyl)ure structure
|
Common Name | 1-(4-Chlorophenyl)-3-(3-methyl-2-pyridinyl)ure | ||
|---|---|---|---|---|
| CAS Number | 5250-80-6 | Molecular Weight | 261.70700 | |
| Density | 1.368g/cm3 | Boiling Point | 321.9ºC at 760 mmHg | |
| Molecular Formula | C13H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5ºC | |
| Name | 1-(4-Chlorophenyl)-3-(3-methyl-2-pyridinyl)ure |
|---|
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 321.9ºC at 760 mmHg |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.70700 |
| Flash Point | 148.5ºC |
| Exact Mass | 261.06700 |
| PSA | 57.51000 |
| LogP | 3.77400 |
| Index of Refraction | 1.687 |
| InChIKey | SQEVRJGQDVQFKB-UHFFFAOYSA-N |
| SMILES | Cc1cccnc1NC(=O)Nc1ccc(Cl)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |