tetranor-PGAM structure
|
Common Name | tetranor-PGAM | ||
|---|---|---|---|---|
| CAS Number | 52510-53-9 | Molecular Weight | 310.342 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 586.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6±22.4 °C | |
Use of tetranor-PGAMtetranor-PGAM is a dehydration product of tetranor-PGEM and can be measured as a surrogate for tetranor-PGEM levels in urine. |
| Name | tetranor-PGAM |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 586.6±35.0 °C at 760 mmHg |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.342 |
| Flash Point | 322.6±22.4 °C |
| Exact Mass | 310.141632 |
| PSA | 108.74000 |
| LogP | -0.12 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | HYPIFMOQVFWSBF-WCQYABFASA-N |
| SMILES | O=C(O)CCCCC(=O)CCC1C=CC(=O)C1CCC(=O)O |
| 8-[(1S,5R)-5-(2-Carboxyethyl)-4-oxo-2-cyclopenten-1-yl]-6-oxooctanoic acid |
| 2-Cyclopentene-1-octanoic acid, 5-(2-carboxyethyl)-ε,4-dioxo-, (1S,5R)- |