2-[(9Z)-9-Octadecenoylamino]ethanesulfonic acid structure
|
Common Name | 2-[(9Z)-9-Octadecenoylamino]ethanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 52514-04-2 | Molecular Weight | 389.593 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H39NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-[(9Z)-9-Octadecenoylamino]ethanesulfonic acidN-Oleoyl taurine is an amino-acyl endocannabinoid isolated from rat brain that may activate TRPV1 and TRPV4. |
| Name | 2-(octadec-9-enoylamino)ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H39NO4S |
| Molecular Weight | 389.593 |
| Exact Mass | 389.259979 |
| PSA | 91.85000 |
| LogP | 5.13 |
| Index of Refraction | 1.489 |
| InChIKey | KOGRJTUIKPMZEJ-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCS(=O)(=O)O |
| 2-[(9Z)-9-Octadecenoylamino]ethanesulfonic acid |
| Ethanesulfonic acid, 2-[[(9Z)-1-oxo-9-octadecen-1-yl]amino]- |
| 2-[(9Z)-Octadec-9-enoylamino]ethanesulfonic acid |