(2s,3s,4r,5r,2's,3's,4'r,5'r)-2,2'-[dithiobis(Methylene)]bis[5-(6-Amino-9h-Purin-9-Yl)tetrahydrofuran-3,4-Diol] structure
|
Common Name | (2s,3s,4r,5r,2's,3's,4'r,5'r)-2,2'-[dithiobis(Methylene)]bis[5-(6-Amino-9h-Purin-9-Yl)tetrahydrofuran-3,4-Diol] | ||
|---|---|---|---|---|
| CAS Number | 5256-83-7 | Molecular Weight | 564.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N10O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2s,3s,4r,5r,2's,3's,4'r,5'r)-2,2'-[dithiobis(Methylene)]bis[5-(6-Amino-9h-Purin-9-Yl)tetrahydrofuran-3,4-Diol] |
|---|
| Molecular Formula | C20H24N10O6S2 |
|---|---|
| Molecular Weight | 564.6 |
| InChIKey | HYGRWPFOTXXMNB-XPWFQUROSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CSSCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)C(O)C1O |
|
Name: Inhibition of human LDH at 100 uM
Source: ChEMBL
Target: L-lactate dehydrogenase
External Id: CHEMBL1063159
|
|
Name: Inhibition of human IMPDH1 at 100 uM
Source: ChEMBL
Target: Inosine-5'-monophosphate dehydrogenase 1
External Id: CHEMBL1063157
|
|
Name: Experimentally measured binding affinity data (Ki) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Ki for protein-ligand complexes
|
|
Name: Inhibition of human IMPDH2 at 100 uM
Source: ChEMBL
Target: Inosine-5'-monophosphate dehydrogenase 2
External Id: CHEMBL1063158
|
|
Name: Inhibition of human NADK by HPLC analysis
Source: ChEMBL
Target: NAD kinase
External Id: CHEMBL5120663
|
|
Name: Inhibition of human LDH
Source: ChEMBL
Target: L-lactate dehydrogenase
External Id: CHEMBL1063155
|
|
Name: Inhibition of human NAD kinase by modified HPLC based assay
Source: ChEMBL
Target: NAD kinase
External Id: CHEMBL1063153
|
|
Name: Inhibition of Mycobacterium tuberculosis NAD kinase by modified HPLC based assay
Source: ChEMBL
Target: NAD kinase
External Id: CHEMBL1063152
|