[N-acetyl-4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]anilino] acetate structure
|
Common Name | [N-acetyl-4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]anilino] acetate | ||
|---|---|---|---|---|
| CAS Number | 52569-57-0 | Molecular Weight | 367.43800 | |
| Density | 1.164g/cm3 | Boiling Point | 499.2ºC at 760 mmHg | |
| Molecular Formula | C22H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.7ºC | |
| Name | [N-acetyl-4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]anilino] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 499.2ºC at 760 mmHg |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.43800 |
| Flash Point | 255.7ºC |
| Exact Mass | 367.17800 |
| PSA | 66.84000 |
| LogP | 4.95400 |
| Index of Refraction | 1.591 |
| InChIKey | CFYPJUZHBJZTPL-QURGRASLSA-N |
| SMILES | CCC(=C(CC)c1ccc(N(OC(C)=O)C(C)=O)cc1)c1ccc(O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Acetoxy-4'-hydroxy-7,7'-diethyl-N-4-stilbenylacetamide |
| N-Acetoxy-4'-hydroxy-7,7'-diethyl-trans-N-4-stilbenylacetamide |
| Acetamide,N-(acetyloxy)-N-(4-(1-ethyl-2-(4-hydroxyphenyl)-1-butenyl)phenyl)-,(E) |