2-Hydroxy-3-methoxy-1,4-naphthalenedione structure
|
Common Name | 2-Hydroxy-3-methoxy-1,4-naphthalenedione | ||
|---|---|---|---|---|
| CAS Number | 5257-83-0 | Molecular Weight | 204.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-methoxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8O4 |
|---|---|
| Molecular Weight | 204.17900 |
| Exact Mass | 204.04200 |
| PSA | 63.60000 |
| LogP | 1.32500 |
| InChIKey | JNBVXNSWFXSRGS-UHFFFAOYSA-N |
| SMILES | COC1=C(O)C(=O)c2ccccc2C1=O |
| HS Code | 2914690090 |
|---|
|
~%
2-Hydroxy-3-met... CAS#:5257-83-0 |
| Literature: Anderson,H.A.; Thomson,R.H. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 426 - 428 |
|
~%
2-Hydroxy-3-met... CAS#:5257-83-0 |
| Literature: Cooke,R.G.; Owen,W.R. Australian Journal of Chemistry, 1962 , vol. 15, p. 486 - 491 |
|
~%
2-Hydroxy-3-met... CAS#:5257-83-0 |
| Literature: Carrara; Bonacci Chimica e l'Industria (Milan, Italy), 1944 , vol. 26, p. 75 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4-Naphthalenedione,2-hydroxy-3-methoxy |
| 1,4-Naphthoquinone,2-hydroxy-3-methoxy |