N-(3,7-dimethylocta-2,6-dienylideneamino)-3-nitrobenzamide
Modify Date: 2024-04-03 22:44:35
N-(3,7-dimethylocta-2,6-dienylideneamino)-3-nitrobenzamide structure
|
Common Name | N-(3,7-dimethylocta-2,6-dienylideneamino)-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5257-84-1 | Molecular Weight | 315.36700 | |
| Density | 1.09g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,7-dimethylocta-2,6-dienylideneamino)-3-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.36700 |
| Exact Mass | 315.15800 |
| PSA | 90.77000 |
| LogP | 5.10110 |
| Index of Refraction | 1.542 |
| InChIKey | ANXSEHNQUCVQGA-HIMLSBAZSA-N |
| SMILES | CC(C)=CCCC(C)=CC=NNC(=O)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[[(2E)-3,7-DIMETHYLOCTA-2,6-DIENYLIDENE]AMINO]-3-NITRO-BENZAMIDE |
| N'-[(1E,2E)-3,7-dimethylocta-2,6-dien-1-ylidene]-3-nitrobenzohydrazide |