Glycine,N-[N-[N-(2,4-dinitrophenyl)glycyl]glycyl]- (6CI,7CI,9CI) structure
|
Common Name | Glycine,N-[N-[N-(2,4-dinitrophenyl)glycyl]glycyl]- (6CI,7CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 52573-81-6 | Molecular Weight | 355.26000 | |
| Density | 1.603g/cm3 | Boiling Point | 825.6ºC at 760 mmHg | |
| Molecular Formula | C12H13N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 453.1ºC | |
| Name | 2-[[2-[[2-(2,4-dinitroanilino)acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 825.6ºC at 760 mmHg |
| Molecular Formula | C12H13N5O8 |
| Molecular Weight | 355.26000 |
| Flash Point | 453.1ºC |
| Exact Mass | 355.07600 |
| PSA | 199.17000 |
| LogP | 1.13310 |
| Index of Refraction | 1.651 |
| InChIKey | SKZUIKAZTCJPJA-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)CNC(=O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
Glycine,N-[N-[N... CAS#:52573-81-6 |
| Literature: Wong; Connors Journal of Pharmaceutical Sciences, 1983 , vol. 72, # 2 p. 146 - 150 |
|
~%
Glycine,N-[N-[N... CAS#:52573-81-6 |
| Literature: Ingram Biochimica et Biophysica Acta, 1956 , vol. 20, p. 577 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n-(2,4-dinitrophenyl)glycylglycylglycine |