2-[(2-bromo-3-phenyl-propanoyl)amino]acetic acid
Modify Date: 2025-12-02 12:29:08
![2-[(2-bromo-3-phenyl-propanoyl)amino]acetic acid Structure](https://image.chemsrc.com/caspic/014/52574-75-1.png)
2-[(2-bromo-3-phenyl-propanoyl)amino]acetic acid structure
|
Common Name | 2-[(2-bromo-3-phenyl-propanoyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 52574-75-1 | Molecular Weight | 286.12200 | |
| Density | 1.539g/cm3 | Boiling Point | 492.7ºC at 760 mmHg | |
| Molecular Formula | C11H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.8ºC | |
| Name | 2-[(2-bromo-3-phenylpropanoyl)amino]acetic acid |
|---|
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 492.7ºC at 760 mmHg |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12200 |
| Flash Point | 251.8ºC |
| Exact Mass | 285.00000 |
| PSA | 66.40000 |
| LogP | 1.58430 |
| Index of Refraction | 1.588 |
| InChIKey | FESBQYCWHVWWCV-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)C(Br)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-[(2-bromo-3-p... CAS#:52574-75-1 |
| Literature: Santen Pharmaceutical Co. Ltd. Patent: US3971828 A1, 1976 ; |
|
~%
2-[(2-bromo-3-p... CAS#:52574-75-1 |
| Literature: Fischer,E.; Schoeller Justus Liebigs Annalen der Chemie, 1907 , vol. 357, p. 11 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |