Methanethioic acid,trithiobis-, O,O-bis(1-methylethyl) ester (9CI)
Modify Date: 2025-09-26 10:54:57
Methanethioic acid,trithiobis-, O,O-bis(1-methylethyl) ester (9CI) structure
|
Common Name | Methanethioic acid,trithiobis-, O,O-bis(1-methylethyl) ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 52584-27-7 | Molecular Weight | 302.52100 | |
| Density | 1.338g/cm3 | Boiling Point | 358.4ºC at 760 mmHg | |
| Molecular Formula | C8H14O2S5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | O-propan-2-yl (propan-2-yloxycarbothioyltrisulfanyl)methanethioate |
|---|
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 358.4ºC at 760 mmHg |
| Molecular Formula | C8H14O2S5 |
| Molecular Weight | 302.52100 |
| Flash Point | 170.6ºC |
| Exact Mass | 301.96000 |
| PSA | 158.54000 |
| LogP | 4.43580 |
| Index of Refraction | 1.636 |
| InChIKey | TXLZTPCDRBQTJT-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=S)SSSC(=S)OC(C)C |
| HS Code | 2930909090 |
|---|
|
~81%
Methanethioic a... CAS#:52584-27-7 |
| Literature: Schroll, Alayne L.; Barany, George Journal of Organic Chemistry, 1986 , vol. 51, # 10 p. 1866 - 1881 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |