3-(6-aminopurin-9-yl)-2-azido-5-(hydroxymethyl)cyclopentan-1-ol structure
|
Common Name | 3-(6-aminopurin-9-yl)-2-azido-5-(hydroxymethyl)cyclopentan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 5259-67-6 | Molecular Weight | 290.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(6-aminopurin-9-yl)-2-azido-5-(hydroxymethyl)cyclopentan-1-ol |
|---|
| Molecular Formula | C11H14N8O2 |
|---|---|
| Molecular Weight | 290.28100 |
| Exact Mass | 290.12400 |
| PSA | 159.83000 |
| LogP | 0.03556 |
| InChIKey | PRAZYXWKEDCLBZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1C(O)C(CO)CC1n1cnc2c(N)ncnc21 |
|
~%
3-(6-aminopurin... CAS#:5259-67-6 |
| Literature: Dreiding; Nickel Journal of the American Chemical Society, 1954 , vol. 76, p. 3965,3967 |
|
~%
3-(6-aminopurin... CAS#:5259-67-6 |
| Literature: Dreiding; Nickel Journal of the American Chemical Society, 1954 , vol. 76, p. 3965,3967 |
|
~%
3-(6-aminopurin... CAS#:5259-67-6 |
| Literature: Dreiding; Nickel Journal of the American Chemical Society, 1954 , vol. 76, p. 3965,3967 |