1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-methyl-1,4-diazepane structure
|
Common Name | 1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-methyl-1,4-diazepane | ||
|---|---|---|---|---|
| CAS Number | 5266-55-7 | Molecular Weight | 262.39000 | |
| Density | 1.004g/cm3 | Boiling Point | 362.6ºC at 760mmHg | |
| Molecular Formula | C16H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.9ºC | |
| Name | 1-[(4-methoxy-2,3-dimethylphenyl)methyl]-4-methyl-1,4-diazepane |
|---|
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 362.6ºC at 760mmHg |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.39000 |
| Flash Point | 101.9ºC |
| Exact Mass | 262.20500 |
| PSA | 15.71000 |
| LogP | 2.32530 |
| Index of Refraction | 1.527 |
| InChIKey | SMCLIPRGMZBISH-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCCN(C)CC2)c(C)c1C |
|
~%
1-[(4-methoxy-2... CAS#:5266-55-7 |
| Literature: Graham, Donald W.; Ashton, Wallace T.; Barash, Louis; Brown, Jeannette E.; Brown, Ronald D.; et al. Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1074 - 1090 |
|
~%
1-[(4-methoxy-2... CAS#:5266-55-7 |
| Literature: Graham, Donald W.; Ashton, Wallace T.; Barash, Louis; Brown, Jeannette E.; Brown, Ronald D.; et al. Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1074 - 1090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |