2,2',3,3',4,4',5,6,6'-pcb structure
|
Common Name | 2,2',3,3',4,4',5,6,6'-pcb | ||
|---|---|---|---|---|
| CAS Number | 52663-79-3 | Molecular Weight | 464.213 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 442.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C12HCl9 | Melting Point | 193.25°C (estimate) | |
| MSDS | N/A | Flash Point | 218.2±24.7 °C | |
| Name | 2,2',3,3',4,4',5,6,6'-Nonachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.5±40.0 °C at 760 mmHg |
| Melting Point | 193.25°C (estimate) |
| Molecular Formula | C12HCl9 |
| Molecular Weight | 464.213 |
| Flash Point | 218.2±24.7 °C |
| Exact Mass | 459.727509 |
| LogP | 7.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | YGDPIDTZOQGPAX-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
|
~%
2,2',3,3',4,4',... CAS#:52663-79-3 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2',3,3',4,4',5,6,6'-pcb |
| 2,2',3,3',4,4',5,6,6'-Nonachlorobiphenyl |
| 2,2',3,3',4,4',5,6,6'-Nonachloro-1,1'-biphenyl |
| 1,2,3,4,5-pentachloro-6-(2,3,4,6-tetrachlorophenyl)benzene |