(2-methyl-6-oxo-1,6-dihydro-5-pyrimidinyl)acetic acid(SALTDATA: FREE) structure
|
Common Name | (2-methyl-6-oxo-1,6-dihydro-5-pyrimidinyl)acetic acid(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 5267-04-9 | Molecular Weight | 204.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H9ClN2O3 |
|---|---|
| Molecular Weight | 204.61100 |
| Exact Mass | 204.03000 |
| PSA | 83.31000 |
| LogP | 0.91970 |
| InChIKey | GTHYWOWXFDJYIT-UHFFFAOYSA-N |
| SMILES | Cc1ncc(CC(=O)O)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~%
(2-methyl-6-oxo... CAS#:5267-04-9 |
| Literature: Cerecedo; Pickel Journal of the American Chemical Society, 1937 , vol. 59, p. 1714 |
|
~%
(2-methyl-6-oxo... CAS#:5267-04-9 |
| Literature: Cerecedo; Pickel Journal of the American Chemical Society, 1937 , vol. 59, p. 1714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-hydroxy-2-methylpyrimidin-5-yl)acetic acid hydrochloride |