(5-methyl-2,4-dinitro-phenyl)-hydrazine structure
|
Common Name | (5-methyl-2,4-dinitro-phenyl)-hydrazine | ||
|---|---|---|---|---|
| CAS Number | 5267-23-2 | Molecular Weight | 212.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-methyl-2,4-dinitro-phenyl)-hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8N4O4 |
|---|---|
| Molecular Weight | 212.16300 |
| Exact Mass | 212.05500 |
| PSA | 129.69000 |
| LogP | 2.91670 |
| InChIKey | YBLLLDQIYSHJCB-UHFFFAOYSA-N |
| SMILES | Cc1cc(NN)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (5-Methyl-2,4-dinitro-phenyl)-hydrazin |
| 4.6-Dinitro-3-hydrazino-toluol |
| 2,4-DINITRO-5-METHYLPHENYLHYDRAZINE |