2,6-ditert-butyl-4-(3-phenylprop-2-enyl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(3-phenylprop-2-enyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 52679-02-4 | Molecular Weight | 322.48400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(3-phenylprop-2-enyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30O |
|---|---|
| Molecular Weight | 322.48400 |
| Exact Mass | 322.23000 |
| PSA | 20.23000 |
| LogP | 6.24310 |
| InChIKey | MBGOPLYUYVRCMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CC=Cc2ccccc2)cc(C(C)(C)C)c1O |
|
~%
2,6-ditert-buty... CAS#:52679-02-4 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US3973040 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Phenol,2,6-bis(1,1-dimethylethyl)-4-(3-phenyl-2-propenyl) |