5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate
Modify Date: 2026-09-28 08:24:07
![5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate Structure](https://www.chemsrc.com/extcaspic/228/52688-46-7.png)
5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate structure
|
Common Name | 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 52688-46-7 | Molecular Weight | 503.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H21N3O3S |
|---|---|
| Molecular Weight | 503.6 |
| InChIKey | PZUNTMMEGPSZJX-FOCLMDBBSA-N |
| SMILES | O=S(=O)(Oc1cc(-n2nc3ccc4ccccc4c3n2)ccc1C=Cc1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: Molecular weight of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is 503.6. |
| Q: What is the English name of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: The English name of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate. |
| Q: What is the molecular formula of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: Molecular formula of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is C30H21N3O3S. |
| Q: What is the Chinese name of 52688-46-7? |
| A: Chinese name of 52688-46-7 is 52688-46-7. |
| Q: What is the CAS number of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: CAS number of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is 52688-46-7. |
| Q: What is the InChIKey of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: InChIKey of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is PZUNTMMEGPSZJX-FOCLMDBBSA-N. |
| Q: What is the SMILES notation of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate? |
| A: SMILES notation of 5-(2H-naphtho[1,2-d][1,2,3]triazol-2-yl)-2-styrylphenyl benzenesulfonate is O=S(=O)(Oc1cc(-n2nc3ccc4ccccc4c3n2)ccc1C=Cc1ccccc1)c1ccccc1. |