4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline
4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline structure
|
Common Name | 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 52688-57-0 | Molecular Weight | 281.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15N3S |
|---|---|
| Molecular Weight | 281.37500 |
| Exact Mass | 281.09900 |
| PSA | 56.73000 |
| LogP | 4.11290 |
| InChIKey | USHHLWOQMLJFGH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Cc2nc3ccccc3s2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(1,3-benzothi... CAS#:52688-57-0 |
| Literature: Hamer Journal of the Chemical Society, 1952 , p. 3197,3208 |
|
~%
4-(1,3-benzothi... CAS#:52688-57-0 |
| Literature: Hamer Journal of the Chemical Society, 1952 , p. 3197,3208 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Benzenediamine,N'-(2-benzothiazolylmethylene)-N,N-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: Molecular formula of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is C16H15N3S. |
| Q: What is the Chinese name of 52688-57-0? |
| A: Chinese name of 52688-57-0 is 52688-57-0. |
| Q: What are the upstream materials of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: Related upstream materials(CAS) of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline: 4123-18-6;6639-57-2;99-98-9. |
| Q: What is the polar surface area (PSA) of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: Polar surface area (PSA) of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is 56.73000. |
| Q: What is the English name of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: The English name of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline. |
| Q: What is the InChIKey of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: InChIKey of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is USHHLWOQMLJFGH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: Molecular weight of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is 281.37500. |
| Q: What is the LogP of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: LogP of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is 4.11290. |
| Q: What is the CAS number of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline? |
| A: CAS number of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline is 52688-57-0. |
| Q: What English synonyms does 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline have? |
| A: English synonyms of 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline: 1,4-Benzenediamine,N'-(2-benzothiazolylmethylene)-N,N-dimethyl. |