4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline structure
|
Common Name | 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 52688-57-0 | Molecular Weight | 281.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,3-benzothiazol-2-ylmethylideneamino)-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15N3S |
|---|---|
| Molecular Weight | 281.37500 |
| Exact Mass | 281.09900 |
| PSA | 56.73000 |
| LogP | 4.11290 |
| InChIKey | USHHLWOQMLJFGH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Cc2nc3ccccc3s2)cc1 |
|
~%
4-(1,3-benzothi... CAS#:52688-57-0 |
| Literature: Hamer Journal of the Chemical Society, 1952 , p. 3197,3208 |
|
~%
4-(1,3-benzothi... CAS#:52688-57-0 |
| Literature: Hamer Journal of the Chemical Society, 1952 , p. 3197,3208 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Benzenediamine,N'-(2-benzothiazolylmethylene)-N,N-dimethyl |