2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine
Modify Date: 2025-09-22 19:22:00
2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine structure
|
Common Name | 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine | ||
|---|---|---|---|---|
| CAS Number | 52688-69-4 | Molecular Weight | 534.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H46N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H46N4 |
|---|---|
| Molecular Weight | 534.8 |
| InChIKey | AIQPJKLUZSYUMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C(C)(C)C)C=C4C(C)(C)C)cc3C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: The English name of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine. |
| Q: What is the molecular weight of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: Molecular weight of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is 534.8. |
| Q: What is the Chinese name of 52688-69-4? |
| A: Chinese name of 52688-69-4 is CC(C)(C)C1=Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C(C)(C)C)C=C4C(C)(C)C)cc3C(C)(C)C. |
| Q: What is the InChIKey of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: InChIKey of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is AIQPJKLUZSYUMB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: Molecular formula of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is C36H46N4. |
| Q: What is the CAS number of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: CAS number of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is 52688-69-4. |
| Q: What is the SMILES notation of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine? |
| A: SMILES notation of 2,7,12,17-Tetrakis(1,1-dimethylethyl)-21H,23H-porphine is CC(C)(C)C1=Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5C(C)(C)C)C=C4C(C)(C)C)cc3C(C)(C)C. |