4-amino-2-sulfobenzoic acid structure
|
Common Name | 4-amino-2-sulfobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 527-76-4 | Molecular Weight | 217.19900 | |
| Density | 1.71g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.19900 |
| Exact Mass | 217.00400 |
| PSA | 126.07000 |
| LogP | 1.87570 |
| Index of Refraction | 1.662 |
| InChIKey | YPNUYFJLBFZDTE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)O)c1 |
| HS Code | 2922499990 |
|---|
|
~%
4-amino-2-sulfo... CAS#:527-76-4 |
| Literature: Giller et al. Latvijas PSR Zinatnu Akademijas Vestis, 1950 , # 3 p. 7,24 Chem.Abstr., 1954 , p. 9964 |
|
~%
4-amino-2-sulfo... CAS#:527-76-4 |
| Literature: Holleman,M. Recueil des Travaux Chimiques des Pays-Bas, 1905 , vol. 24, p. 206 |
|
~%
Detail
|
| Literature: Holleman,M. Recueil des Travaux Chimiques des Pays-Bas, 1905 , vol. 24, p. 206 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-benzoesaeure-sulfonsaeure-(2) |
| 1-amino-4-carboxybenzene-3-sulfonic acid |
| 4-Amino-2-sulfobenzoicacid |
| p-Amino-o-sulfobenzoic acid |
| Benzoic acid,4-amino-2-sulfo |
| MFCD07779293 |
| 4-Amino-2-sulfo-benzoesaeure |