2,4-dibromo-6-[(cyclohexylamino)methyl]phenol
![2,4-dibromo-6-[(cyclohexylamino)methyl]phenol Structure](https://image.chemsrc.com/caspic/417/52702-75-7.png)
2,4-dibromo-6-[(cyclohexylamino)methyl]phenol structure
|
Common Name | 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 52702-75-7 | Molecular Weight | 363.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17Br2NO |
|---|---|
| Molecular Weight | 363.08800 |
| Exact Mass | 360.96800 |
| PSA | 32.26000 |
| LogP | 4.73040 |
| InChIKey | GQCQBHIXPZFKGM-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc(Br)cc1CNC1CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dibromo-6-[... CAS#:52702-75-7 |
| Literature: Burke,W.J. et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 909 - 912 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenol,2,4-dibromo-6-[(cyclohexylamino)methyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: Related upstream materials(CAS) of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol: 50-00-0;615-58-7;108-91-8. |
| Q: What is the SMILES notation of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: SMILES notation of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is Oc1c(Br)cc(Br)cc1CNC1CCCCC1. |
| Q: What is the English name of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: The English name of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol. |
| Q: What is the InChIKey of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: InChIKey of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is GQCQBHIXPZFKGM-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: Polar surface area (PSA) of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is 32.26000. |
| Q: What is the molecular formula of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: Molecular formula of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is C13H17Br2NO. |
| Q: What is the Chinese name of 52702-75-7? |
| A: Chinese name of 52702-75-7 is 52702-75-7. |
| Q: What is the CAS number of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: CAS number of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is 52702-75-7. |
| Q: What is the molecular weight of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: Molecular weight of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is 363.08800. |
| Q: What is the LogP of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol? |
| A: LogP of 2,4-dibromo-6-[(cyclohexylamino)methyl]phenol is 4.73040. |