Benzoic acid,2,2'-sulfinylbis- (9CI) structure
|
Common Name | Benzoic acid,2,2'-sulfinylbis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 52704-04-8 | Molecular Weight | 290.29100 | |
| Density | 1.59g/cm3 | Boiling Point | 581ºC at 760mmHg | |
| Molecular Formula | C14H10O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.2ºC | |
| Name | 2-(2-carboxyphenyl)sulfinylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 581ºC at 760mmHg |
| Molecular Formula | C14H10O5S |
| Molecular Weight | 290.29100 |
| Flash Point | 305.2ºC |
| Exact Mass | 290.02500 |
| PSA | 110.88000 |
| LogP | 3.11540 |
| Index of Refraction | 1.734 |
| InChIKey | HMNPICHEHWVPNJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1S(=O)c1ccccc1C(=O)O |
|
~92%
Benzoic acid,2,... CAS#:52704-04-8 |
| Literature: Rabai, Jozsef; Kapovits, Istvan; Tanacs, Bela; Tamas, Jozsef Synthesis, 1990 , # 9 p. 847 - 849 |
|
~%
Benzoic acid,2,... CAS#:52704-04-8 |
| Literature: Vass, Elemer; Ruff, Ferenc; Kapovits, Istvan; Rabai, Jozsef; Szabo, Denes Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1993 , # 5 p. 855 - 859 |
|
~%
Benzoic acid,2,... CAS#:52704-04-8 |
| Literature: Mayer Chemische Berichte, 1910 , vol. 43, p. 590 |
|
~%
Benzoic acid,2,... CAS#:52704-04-8 |
| Literature: Mayer Chemische Berichte, 1910 , vol. 43, p. 590 |
| o,o'-Sulfinyl dibenzoic acid |