diethyl(diphenyl)phosphanium,iodide structure
|
Common Name | diethyl(diphenyl)phosphanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 5271-36-3 | Molecular Weight | 370.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20IP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl(diphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H20IP |
|---|---|
| Molecular Weight | 370.20800 |
| Exact Mass | 370.03500 |
| PSA | 13.59000 |
| LogP | 0.69880 |
| InChIKey | NEKFEYXDJYXFBJ-UHFFFAOYSA-M |
| SMILES | CC[P+](CC)(c1ccccc1)c1ccccc1.[I-] |
| HS Code | 2931900090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonium,diethyldiphenyl-,iodide |
| diethyl(diphenyl)phosphanium iodide |
| diethyl(diphenyl)phosphonium iodide |