1-(4-Chlorophenyl)-5-phenyl-1H-imidazo[1,5-b][1,2,4]triazole structure
|
Common Name | 1-(4-Chlorophenyl)-5-phenyl-1H-imidazo[1,5-b][1,2,4]triazole | ||
|---|---|---|---|---|
| CAS Number | 52713-18-5 | Molecular Weight | 294.73800 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-5-phenylimidazo[1,5-b][1,2,4]triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 294.73800 |
| Exact Mass | 294.06700 |
| PSA | 35.12000 |
| LogP | 3.84040 |
| Index of Refraction | 1.711 |
| InChIKey | WUPIZZVMZCPNKQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-n2cnn3c(-c4ccccc4)ncc23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Chlorophenyl)-5-phenyl-1H-imidazo(1,5-b)(1,2,4)triazole |