3(2H)-Pyridazinone,5-(4-morpholinyl)-2-phenyl-4-[(phenylmethyl)thio]- structure
|
Common Name | 3(2H)-Pyridazinone,5-(4-morpholinyl)-2-phenyl-4-[(phenylmethyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 5273-14-3 | Molecular Weight | 379.47500 | |
| Density | 1.26g/cm3 | Boiling Point | 521.8ºC at 760mmHg | |
| Molecular Formula | C21H21N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.3ºC | |
| Name | 4-benzylsulfanyl-5-morpholin-4-yl-2-phenylpyridazin-3-one |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 521.8ºC at 760mmHg |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.47500 |
| Flash Point | 269.3ºC |
| Exact Mass | 379.13500 |
| PSA | 72.66000 |
| LogP | 3.42640 |
| Index of Refraction | 1.652 |
| InChIKey | BMRMCKZUNQUYKG-UHFFFAOYSA-N |
| SMILES | O=c1c(SCc2ccccc2)c(N2CCOCC2)cnn1-c1ccccc1 |
| HS Code | 2934999090 |
|---|
|
~%
3(2H)-Pyridazin... CAS#:5273-14-3 |
| Literature: Castle,R.N.; Kaji,K. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 463 - 472 |
|
~%
3(2H)-Pyridazin... CAS#:5273-14-3 |
| Literature: Castle,R.N.; Kaji,K. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 463 - 472 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |