Naphtho[1,2-b]phenazin-5 (8H)-one, 6-chloro-8-ethyl- structure
|
Common Name | Naphtho[1,2-b]phenazin-5 (8H)-one, 6-chloro-8-ethyl- | ||
|---|---|---|---|---|
| CAS Number | 52736-85-3 | Molecular Weight | 358.82000 | |
| Density | 1.35g/cm3 | Boiling Point | 478.8ºC at 760 mmHg | |
| Molecular Formula | C22H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | 6-chloro-8-ethylnaphtho[1,2-b]phenazin-5-one |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760 mmHg |
| Molecular Formula | C22H15ClN2O |
| Molecular Weight | 358.82000 |
| Flash Point | 243.4ºC |
| Exact Mass | 358.08700 |
| PSA | 34.89000 |
| LogP | 5.52940 |
| Index of Refraction | 1.708 |
| InChIKey | HFGXSHZHMMUJDB-UHFFFAOYSA-N |
| SMILES | CCn1c2ccccc2nc2cc3c(cc21)c(Cl)c(=O)c1ccccc13 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |