dibenzyl 2-(2-phenylmethoxycarbonylaminopropanoylamino)pentanedioate structure
|
Common Name | dibenzyl 2-(2-phenylmethoxycarbonylaminopropanoylamino)pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 5276-60-8 | Molecular Weight | 532.58400 | |
| Density | 1.225g/cm3 | Boiling Point | 719.5ºC at 760 mmHg | |
| Molecular Formula | C30H32N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.9ºC | |
| Name | dibenzyl 2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanedioate |
|---|
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 719.5ºC at 760 mmHg |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.58400 |
| Flash Point | 388.9ºC |
| Exact Mass | 532.22100 |
| PSA | 120.03000 |
| LogP | 4.83490 |
| Index of Refraction | 1.574 |
| InChIKey | ZAYYONRHDVZFMP-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|
~%
dibenzyl 2-(2-p... CAS#:5276-60-8 |
| Literature: Sachs; Brand Journal of the American Chemical Society, 1953 , vol. 75, p. 4608 |
|
~%
dibenzyl 2-(2-p... CAS#:5276-60-8 |
| Literature: Ohyama, Satoshi; Ishibashi, Norio; Tamura, Masahiro; Nishizaki, Hiroshi; Okai, Hideo Agricultural and Biological Chemistry, 1988 , vol. 52, # 3 p. 871 - 872 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |