N-Fmoc-3-iodo-D-alanine methyl ester
Modify Date: 2026-06-28 11:25:16
N-Fmoc-3-iodo-D-alanine methyl ester structure
|
Common Name | N-Fmoc-3-iodo-D-alanine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 527696-77-1 | Molecular Weight | 451.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Fmoc-3-iodo-D-alanine methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18INO4 |
|---|---|
| Molecular Weight | 451.3 |
| InChIKey | CWUVRMHOLORRBM-QGZVFWFLSA-N |
| SMILES | COC(=O)C(CI)NC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: The English name of N-Fmoc-3-iodo-D-alanine methyl ester is N-Fmoc-3-iodo-D-alanine methyl ester. |
| Q: What is the SMILES notation of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: SMILES notation of N-Fmoc-3-iodo-D-alanine methyl ester is COC(=O)C(CI)NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the CAS number of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: CAS number of N-Fmoc-3-iodo-D-alanine methyl ester is 527696-77-1. |
| Q: What is the Chinese name of 527696-77-1? |
| A: Chinese name of 527696-77-1 is 527696-77-1. |
| Q: What is the molecular formula of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: Molecular formula of N-Fmoc-3-iodo-D-alanine methyl ester is C19H18INO4. |
| Q: What is the molecular weight of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: Molecular weight of N-Fmoc-3-iodo-D-alanine methyl ester is 451.3. |
| Q: What is the InChIKey of N-Fmoc-3-iodo-D-alanine methyl ester? |
| A: InChIKey of N-Fmoc-3-iodo-D-alanine methyl ester is CWUVRMHOLORRBM-QGZVFWFLSA-N. |