3,5-dichloroacetoacetanilid structure
|
Common Name | 3,5-dichloroacetoacetanilid | ||
|---|---|---|---|---|
| CAS Number | 52793-04-1 | Molecular Weight | 246.09000 | |
| Density | 1.393g/cm3 | Boiling Point | 418ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | 3,5-dichloroacetoacetanilid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 418ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09000 |
| Flash Point | 206.6ºC |
| Exact Mass | 245.00100 |
| PSA | 46.17000 |
| LogP | 2.98400 |
| Index of Refraction | 1.59 |
| InChIKey | GYNIUNAMMNVZCZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1cc(Cl)cc(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-Dichloroacetoacetanilide |