(4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride
Modify Date: 2026-08-09 17:41:50
(4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride structure
|
Common Name | (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 52798-05-7 | Molecular Weight | 271.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18ClNO3 |
|---|---|
| Molecular Weight | 271.74 |
| InChIKey | UWZUDPALSMFUST-UHFFFAOYSA-N |
| SMILES | CCOC(=N)c1ccc(CC(=O)OCC)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 52798-05-7? |
| A: Chinese name of 52798-05-7 is 52798-05-7. |
| Q: What is the SMILES notation of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: SMILES notation of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is CCOC(=N)c1ccc(CC(=O)OCC)cc1.Cl. |
| Q: What is the molecular formula of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: Molecular formula of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is C13H18ClNO3. |
| Q: What is the molecular weight of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: Molecular weight of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is 271.74. |
| Q: What is the CAS number of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: CAS number of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is 52798-05-7. |
| Q: What is the InChIKey of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: InChIKey of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is UWZUDPALSMFUST-UHFFFAOYSA-N. |
| Q: What is the English name of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride? |
| A: The English name of (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride is (4-Ethoxycarbonimidoyl-phenyl)-acetic acid ethyl ester hydrochloride. |