4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid
Modify Date: 2025-09-12 18:23:08
4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid structure
|
Common Name | 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 528-47-2 | Molecular Weight | 188.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9FO4 |
|---|---|
| Molecular Weight | 188.15 |
| InChIKey | WHKSDSRZFBQQPM-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC=C(F)CC1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 528-47-2? |
| A: Chinese name of 528-47-2 is 528-47-2. |
| Q: What is the InChIKey of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: InChIKey of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is WHKSDSRZFBQQPM-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: The English name of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid. |
| Q: What is the CAS number of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: CAS number of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is 528-47-2. |
| Q: What is the SMILES notation of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: SMILES notation of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is O=C(O)C1CC=C(F)CC1C(=O)O. |
| Q: What is the molecular weight of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: Molecular weight of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is 188.15. |
| Q: What is the molecular formula of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid? |
| A: Molecular formula of 4-Fluoro-4-cyclohexene-1,2-dicarboxylic acid is C8H9FO4. |