3-METHOXY-2-[(4-METHYLBENZYL)OXY]BENZALDEHYDE
![3-METHOXY-2-[(4-METHYLBENZYL)OXY]BENZALDEHYDE Structure](https://image.chemsrc.com/caspic/350/52803-64-2.png)
3-METHOXY-2-[(4-METHYLBENZYL)OXY]BENZALDEHYDE structure
|
Common Name | 3-METHOXY-2-[(4-METHYLBENZYL)OXY]BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 52803-64-2 | Molecular Weight | 256.29600 | |
| Density | 1.133g/cm3 | Boiling Point | 401.2ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
Summary: 3-METHOXY-2-[(4-METHYLBENZYL)OXY]BENZALDEHYDE (CAS: 52803-64-2) is an organic compound with molecular formula C16H16O3 and molecular weight 256.29600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 401.2ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 188ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 3.39510 |
| Index of Refraction | 1.584 |
| InChIKey | YQGOAKNOLJOAPM-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=O)c1OCc1ccc(C)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2912499000 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-METHOXY-2-[(4... CAS#:52803-64-2 |
| Literature: Nippon Soda Patent: FR2204351 , 1974 ; Chem.Abstr., 1975 , vol. 82, # 150523 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: CAS number of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 52803-64-2. |
| Q: What is the English name of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: The English name of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde. |
| Q: What is the molecular weight of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: Molecular weight of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 256.29600. |
| Q: What is the boiling point of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: Boiling point of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 401.2ºC at 760 mmHg. |
| Q: What is the LogP of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: LogP of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 3.39510. |
| Q: What is the SMILES notation of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: SMILES notation of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is COc1cccc(C=O)c1OCc1ccc(C)cc1. |
| Q: What is the molecular formula of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: Molecular formula of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is C16H16O3. |
| Q: What is the polar surface area (PSA) of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: Polar surface area (PSA) of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is 35.53000. |
| Q: What are the upstream materials of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: Related upstream materials(CAS) of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde: 148-53-8;104-82-5. |
| Q: What is the InChIKey of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde? |
| A: InChIKey of 3-methoxy-2-[(4-methylphenyl)methoxy]benzaldehyde is YQGOAKNOLJOAPM-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |