(2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane
Modify Date: 2025-09-25 20:57:24
(2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane structure
|
Common Name | (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane | ||
|---|---|---|---|---|
| CAS Number | 52809-69-5 | Molecular Weight | 309.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14Cl2O2 |
|---|---|
| Molecular Weight | 309.2 |
| InChIKey | ROPBIZIYEZEHIP-IYBDPMFKSA-N |
| SMILES | Clc1ccc(C2OCCOC2c2ccc(Cl)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: SMILES notation of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is Clc1ccc(C2OCCOC2c2ccc(Cl)cc2)cc1. |
| Q: What is the Chinese name of 52809-69-5? |
| A: Chinese name of 52809-69-5 is 52809-69-5. |
| Q: What is the molecular weight of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: Molecular weight of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is 309.2. |
| Q: What is the CAS number of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: CAS number of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is 52809-69-5. |
| Q: What is the molecular formula of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: Molecular formula of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is C16H14Cl2O2. |
| Q: What is the InChIKey of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: InChIKey of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is ROPBIZIYEZEHIP-IYBDPMFKSA-N. |
| Q: What is the English name of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane? |
| A: The English name of (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane is (2R,3S)-2,3-Bis(4-chlorophenyl)-1,4-dioxane. |