2,4-dimethylquinoline-5,8-dione structure
|
Common Name | 2,4-dimethylquinoline-5,8-dione | ||
|---|---|---|---|---|
| CAS Number | 52824-08-5 | Molecular Weight | 187.19500 | |
| Density | 1.262g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | 2,4-dimethylquinoline-5,8-dione |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.19500 |
| Flash Point | 199ºC |
| Exact Mass | 187.06300 |
| PSA | 47.03000 |
| LogP | 1.63360 |
| Index of Refraction | 1.598 |
| InChIKey | GWHILZONOPRFRA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(n1)C(=O)C=CC2=O |
|
~%
2,4-dimethylqui... CAS#:52824-08-5 |
| Literature: Long; Schofield Journal of the Chemical Society, 1953 , p. 3161,3166 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |