Benzenesulfonic acid,4-methyl-, 2-(2-methylcyclohexylidene)hydrazide
Benzenesulfonic acid,4-methyl-, 2-(2-methylcyclohexylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(2-methylcyclohexylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 52826-41-2 | Molecular Weight | 405.5 | |
| Density | 1.22g/cm3 | Boiling Point | 419.7ºC at 760mmHg | |
| Molecular Formula | C25H28NO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760mmHg |
| Molecular Formula | C25H28NO2P |
| Molecular Weight | 405.5 |
| Flash Point | 207.6ºC |
| Exact Mass | 405.18576613 |
| PSA | 66.91000 |
| LogP | 4.31110 |
| Index of Refraction | 1.591 |
| InChIKey | GRUZSGIAOOBDNN-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCC(C2=CC=CC=C2)P(=O)(C3=CC=CC=C3)C4=CC=CC=C4 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
Benzenesulfonic... CAS#:52826-41-2 |
| Literature: Winfield, Christopher J.; Al-Mahrizy, Zeyana; Gravestock, Michael; Bugg, Timothy D.H. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 19 p. 3277 - 3289 |
|
~%
Benzenesulfonic... CAS#:52826-41-2 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 6 | |
CAS#:591-49-1
CAS#:591-48-0
CAS#:1759-64-4
CAS#:72018-30-5
CAS#:63031-68-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: SMILES notation of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is C1COCCN1CCC(C2=CC=CC=C2)P(=O)(C3=CC=CC=C3)C4=CC=CC=C4. |
| Q: What is the polar surface area (PSA) of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: Polar surface area (PSA) of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is 66.91000. |
| Q: What is the Chinese name of 52826-41-2? |
| A: Chinese name of 52826-41-2 is 52826-41-2. |
| Q: What is the boiling point of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: Boiling point of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is 419.7ºC at 760mmHg. |
| Q: What is the LogP of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: LogP of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is 4.31110. |
| Q: What is the InChIKey of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: InChIKey of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is GRUZSGIAOOBDNN-UHFFFAOYSA-N. |
| Q: What are the upstream materials of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: Related upstream materials(CAS) of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide: 583-60-8;1576-35-8;98-59-9. |
| Q: What is the CAS number of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: CAS number of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is 52826-41-2. |
| Q: What is the English name of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: The English name of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide. |
| Q: What is the molecular weight of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide? |
| A: Molecular weight of (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide is 405.5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |