Benzenesulfonic acid,4-methyl-, 2-(2-methylcyclohexylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(2-methylcyclohexylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 52826-41-2 | Molecular Weight | 405.5 | |
| Density | 1.22g/cm3 | Boiling Point | 419.7ºC at 760mmHg | |
| Molecular Formula | C25H28NO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | (Z)-4-methyl-N'-(2-methylcyclohexylidene)benzenesulfonohydrazide |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760mmHg |
| Molecular Formula | C25H28NO2P |
| Molecular Weight | 405.5 |
| Flash Point | 207.6ºC |
| Exact Mass | 405.18576613 |
| PSA | 66.91000 |
| LogP | 4.31110 |
| Index of Refraction | 1.591 |
| InChIKey | GRUZSGIAOOBDNN-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCC(C2=CC=CC=C2)P(=O)(C3=CC=CC=C3)C4=CC=CC=C4 |
|
~99%
Benzenesulfonic... CAS#:52826-41-2 |
| Literature: Winfield, Christopher J.; Al-Mahrizy, Zeyana; Gravestock, Michael; Bugg, Timothy D.H. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 19 p. 3277 - 3289 |
|
~%
Benzenesulfonic... CAS#:52826-41-2 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |