Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate
Modify Date: 2026-06-27 20:14:24
Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate structure
|
Common Name | Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 52889-75-5 | Molecular Weight | 348.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20O7 |
|---|---|
| Molecular Weight | 348.3 |
| InChIKey | MULBTAGQSFGNAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)CC1=C(C2=C(O1)C(=C(C(=C2O)C)O)C(=O)C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: CAS number of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is 52889-75-5. |
| Q: What is the molecular weight of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: Molecular weight of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is 348.3. |
| Q: What is the molecular formula of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: Molecular formula of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is C18H20O7. |
| Q: What is the Chinese name of 52889-75-5? |
| A: Chinese name of 52889-75-5 is 52889-75-5. |
| Q: What is the English name of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: The English name of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate. |
| Q: What is the SMILES notation of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: SMILES notation of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is CCOC(=O)CC(=O)CC1=C(C2=C(O1)C(=C(C(=C2O)C)O)C(=O)C)C. |
| Q: What is the InChIKey of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate? |
| A: InChIKey of Ethyl 4-(7-acetyl-4,6-dihydroxy-3,5-dimethyl-1-benzofuran-2-yl)-3-oxobutanoate is MULBTAGQSFGNAK-UHFFFAOYSA-N. |