Phenol,3-(trifluoromethyl)-, 1-methanesulfonate structure
|
Common Name | Phenol,3-(trifluoromethyl)-, 1-methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 52904-17-3 | Molecular Weight | 240.20000 | |
| Density | 1.429g/cm3 | Boiling Point | 290ºC at 760 mmHg | |
| Molecular Formula | C8H7F3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2ºC | |
| Name | [3-(trifluoromethyl)phenyl] methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 290ºC at 760 mmHg |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 240.20000 |
| Flash Point | 129.2ºC |
| Exact Mass | 240.00700 |
| PSA | 51.75000 |
| LogP | 3.12460 |
| Index of Refraction | 1.47 |
| InChIKey | DISXDOUPJHUOMQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Oc1cccc(C(F)(F)F)c1 |
|
~91%
Phenol,3-(trifl... CAS#:52904-17-3 |
| Literature: Munday, Rachel H.; Martinelli, Joseph R.; Buchwald, Stephen L. Journal of the American Chemical Society, 2008 , vol. 130, # 9 p. 2754 - 2755 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Trifluormethylphenyl-methansulfonat |