ethyl 9-methoxy-9-phenyl-3-azabicyclo[3.3.1]nonane-3-carboxylate structure
|
Common Name | ethyl 9-methoxy-9-phenyl-3-azabicyclo[3.3.1]nonane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 52904-49-1 | Molecular Weight | 303.39600 | |
| Density | 1.13g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C18H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | ethyl 9-methoxy-9-phenyl-3-azabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.39600 |
| Flash Point | 201.7ºC |
| Exact Mass | 303.18300 |
| PSA | 38.77000 |
| LogP | 3.35460 |
| Index of Refraction | 1.555 |
| InChIKey | AESIKVFHLLNBDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CC2CCCC(C1)C2(OC)c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Azabicyclo(3.3.1)nonane-3-carboxylic acid,9-methoxy-9-phenyl-,ethyl ester,syn |
| syn-9-Methoxy-9-phenyl-3-azabicyclo(3.3.1)nonane-3-carboxylic acid ethyl ester |