ethyl 2-anilinocyclopentene-1-carboxylate structure
|
Common Name | ethyl 2-anilinocyclopentene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 52909-66-7 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-anilinocyclopentene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 38.33000 |
| LogP | 3.17260 |
| InChIKey | RNDODFVKQYVWSO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)CCC1 |
|
~%
ethyl 2-anilino... CAS#:52909-66-7 |
| Literature: University of Strathclyde Patent: US6130228 A1, 2000 ; |
|
~99%
ethyl 2-anilino... CAS#:52909-66-7 |
| Literature: Vohra, Ramandeep Kaur; Renaud, Jean-Luc; Bruneau, Christian Collection of Czechoslovak Chemical Communications, 2005 , vol. 70, # 11 p. 1943 - 1952 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| ethyl 2-(N-phenylamino)-1-cyclopentene-1-carboxylate |
| 2-Phenylimino-cyclopentan-carbonsaeure-(1)-aethylester |
| ethyl 1-Anilino-1-cyclopentene-2-carboxylate |
| 2-anilino-cyclopent-1-enecarboxylic acid ethyl ester |
| 1-Cyclopentene-1-carboxylic acid,2-(phenylamino)-,ethyl ester |
| ethyl 2-(phenylamino)cyclopent-1-enecarboxylate |
| ethyl 2-anilinocyclopent-1-ene-1-carboxylate |
| 2-Anilino-cyclopent-1-encarbonsaeure-aethylester |