N-Methyl-N-(chlorothio)-p-toluenesulfonamide
Modify Date: 2025-10-10 04:57:45
N-Methyl-N-(chlorothio)-p-toluenesulfonamide structure
|
Common Name | N-Methyl-N-(chlorothio)-p-toluenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 52913-45-8 | Molecular Weight | 251.75300 | |
| Density | 1.397g/cm3 | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C8H10ClNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | [methyl-(4-methylphenyl)sulfonylamino] thiohypochlorite |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760 mmHg |
| Molecular Formula | C8H10ClNO2S2 |
| Molecular Weight | 251.75300 |
| Flash Point | 171.5ºC |
| Exact Mass | 250.98400 |
| PSA | 71.06000 |
| LogP | 3.49830 |
| Index of Refraction | 1.599 |
| InChIKey | NAWQKWLDGDPPJR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)SCl)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
N-Methyl-N-(chl... CAS#:52913-45-8 |
| Literature: Grant, Jonathan W.; Smyth, Timothy P. Journal of Organic Chemistry, 2004 , vol. 69, # 23 p. 7965 - 7970 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-chlorothio-N-methyl-p-toluenesulfonamide |
| n-(chlorosulfanyl)-n,4-dimethylbenzenesulfonamide |
| Amidosulfenyl chloride,N-methyl-N-((4-methylphenyl)sulfonyl) |
| S-chloro-N-methyl-N-(toluene-4-sulfonyl)-thiohydroxylamine |
| (p-Toluol-sulfonsaeure-methylamido)-N-sulfonsaeurechlorid |
| methyl-(toluene-4-sulfonyl)-amidosulfenyl chloride |
| Amidosulfenyl chloride,methyl((4-methylphenyl)sulfonyl) |
| N-chlorothio-N-methyl-4-toluenesulphonamide |