(2-bromo-2-phenyl-ethenyl)sulfonylbenzene structure
|
Common Name | (2-bromo-2-phenyl-ethenyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 52920-43-1 | Molecular Weight | 323.20500 | |
| Density | 1.492g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C14H11BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | [(E)-2-(benzenesulfonyl)-1-bromoethenyl]benzene |
|---|
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C14H11BrO2S |
| Molecular Weight | 323.20500 |
| Flash Point | 231.5ºC |
| Exact Mass | 321.96600 |
| PSA | 42.52000 |
| LogP | 4.93460 |
| Index of Refraction | 1.628 |
| InChIKey | KZEKKKHNXUUYJO-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C(=CS(=O)(=O)C2=CC=CC=C2)/Br |
|
~71%
(2-bromo-2-phen... CAS#:52920-43-1 |
| Literature: Taniguchi, Nobukazu Tetrahedron, 2014 , vol. 70, # 11 p. 1984 - 1990 |
|
~38%
(2-bromo-2-phen... CAS#:52920-43-1 |
| Literature: Li, Xiaoqing; Shi, Xinhua; Fang, Mingwu; Xu, Xiangsheng Journal of Organic Chemistry, 2013 , vol. 78, # 18 p. 9499 - 9504 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |